C18H20ClN3O — CID 75605889
N-[(4-chlorophenyl)methyl]-5-(4-methylphenyl)pyrazolidine-3-carboxamide (PubChem CID 75605889) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-5-(4-methylphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-5-(4-methylphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75605889 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-5-(4-methylphenyl)pyrazolidine-3-carboxamide |
| SMILES | Cc1ccc(C2CC(C(=O)NCc3ccc(Cl)cc3)NN2)cc1 |
| InChI | InChI=1S/C18H20ClN3O/c1-12-2-6-14(7-3-12)16-10-17(22-21-16)18(23)20-11-13-4-8-15(19)9-5-13/h2-9,16-17,21-22H,10-11H2,1H3,(H,20,23) |
| InChIKey | SPYFQKWDPGTVKJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |