C18H18N4O3S — CID 7304305
1-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]-3-(4-nitrophenyl)thiourea (PubChem CID 7304305) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 7304305 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[[(1S,2R)-2-(4-methylphenyl)cyclopropanecarbonyl]amino]-3-(4-nitrophenyl)thiourea |
| SMILES | Cc1ccc([C@@H]2C[C@@H]2C(=O)NNC(=S)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-11-2-4-12(5-3-11)15-10-16(15)17(23)20-21-18(26)19-13-6-8-14(9-7-13)22(24)25/h2-9,15-16H,10H2,1H3,(H,20,23)(H2,19,21,26)/t15-,16-/m0/s1 |
| InChIKey | KVBGNVKBNUYMPN-HOTGVXAUSA-N |
| XLogP | 3.02 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|