C17H23N5O2S — CID 74774993
N-[[3-(1,3-benzodioxol-5-yl)pyrazolidin-4-yl]methyl]-2-(1-methylimidazol-2-yl)sulfanylethanamine (PubChem CID 74774993) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yl)pyrazolidin-4-yl]methyl]-2-(1-methylimidazol-2-yl)sulfanylethanamine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yl)pyrazolidin-4-yl]methyl]-2-(1-methylimidazol-2-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 74774993 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yl)pyrazolidin-4-yl]methyl]-2-(1-methylimidazol-2-yl)sulfanylethanamine |
| SMILES | Cn1ccnc1SCCNCC1CNNC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H23N5O2S/c1-22-6-4-19-17(22)25-7-5-18-9-13-10-20-21-16(13)12-2-3-14-15(8-12)24-11-23-14/h2-4,6,8,13,16,18,20-21H,5,7,9-11H2,1H3 |
| InChIKey | DGLSYBMKWXVBOL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|