C22H25N7O2S — CID 74776650
N-[5-methyl-2-[1-(3-methylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]pyrazol-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 74776650) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is N-[5-methyl-2-[1-(3-methylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]pyrazol-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-methyl-2-[1-(3-methylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]pyrazol-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 74776650 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[5-methyl-2-[1-(3-methylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]pyrazol-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1cccc(N2NCC3C(=O)NC(n4nc(C)cc4NC(=O)Cc4cccs4)NC32)c1 |
| InChI | InChI=1S/C22H25N7O2S/c1-13-5-3-6-15(9-13)28-20-17(12-23-28)21(31)26-22(25-20)29-18(10-14(2)27-29)24-19(30)11-16-7-4-8-32-16/h3-10,17,20,22-23,25H,11-12H2,1-2H3,(H,24,30)(H,26,31) |
| InChIKey | AQQCDQBHGGCCAU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |