C23H29N3OS — CID 74787354
[3-[4-(2-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]-(4-methylsulfanylphenyl)methanone (PubChem CID 74787354) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is [3-[4-(2-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]-(4-methylsulfanylphenyl)methanone.
| Compound Name | [3-[4-(2-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]-(4-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 74787354 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [3-[4-(2-methylphenyl)pyrazolidin-3-yl]piperidin-1-yl]-(4-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(C(=O)N2CCCC(C3NNCC3c3ccccc3C)C2)cc1 |
| InChI | InChI=1S/C23H29N3OS/c1-16-6-3-4-8-20(16)21-14-24-25-22(21)18-7-5-13-26(15-18)23(27)17-9-11-19(28-2)12-10-17/h3-4,6,8-12,18,21-22,24-25H,5,7,13-15H2,1-2H3 |
| InChIKey | AKFQHJBUDFKXBT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |