C11H14N2O2Si — CID 74788064
(NZ)-N-[(2-trimethylsilylfuro[3,2-b]pyridin-6-yl)methylidene]hydroxylamine (PubChem CID 74788064) has the molecular formula C11H14N2O2Si and a molecular weight of 234.33 g/mol. Its IUPAC name is (NZ)-N-[(2-trimethylsilylfuro[3,2-b]pyridin-6-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2-trimethylsilylfuro[3,2-b]pyridin-6-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 74788064 |
| Molecular Formula | C11H14N2O2Si |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (NZ)-N-[(2-trimethylsilylfuro[3,2-b]pyridin-6-yl)methylidene]hydroxylamine |
| SMILES | C[Si](C)(C)c1cc2ncc(/C=N\O)cc2o1 |
| InChI | InChI=1S/C11H14N2O2Si/c1-16(2,3)11-5-9-10(15-11)4-8(6-12-9)7-13-14/h4-7,14H,1-3H3/b13-7- |
| InChIKey | CQNPYIXCRNPAEL-QPEQYQDCSA-N |
| XLogP | 2.18 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|