C8H6N2O2 — CID 119083195
(NE)-N-(1,3-benzoxazol-5-ylmethylidene)hydroxylamine (PubChem CID 119083195) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is (NE)-N-(1,3-benzoxazol-5-ylmethylidene)hydroxylamine.
| Compound Name | (NE)-N-(1,3-benzoxazol-5-ylmethylidene)hydroxylamine |
|---|---|
| PubChem CID | 119083195 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (NE)-N-(1,3-benzoxazol-5-ylmethylidene)hydroxylamine |
| SMILES | O/N=C/c1ccc2ocnc2c1 |
| InChI | InChI=1S/C8H6N2O2/c11-10-4-6-1-2-8-7(3-6)9-5-12-8/h1-5,11H/b10-4+ |
| InChIKey | VKMMYWXVFJXPLY-ONNFQVAWSA-N |
| XLogP | 1.64 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|