C17H24N2O5 — CID 7479843
[(1R)-2-oxocyclohexyl] 2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate (PubChem CID 7479843) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 7479843 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-[(5R,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CC(=O)O[C@@H]1CCCCC1=O)C2=O |
| InChI | InChI=1S/C17H24N2O5/c1-11-6-4-5-9-17(11)15(22)19(16(23)18-17)10-14(21)24-13-8-3-2-7-12(13)20/h11,13H,2-10H2,1H3,(H,18,23)/t11-,13+,17+/m0/s1 |
| InChIKey | ZMZAJNWRIJLSRS-XTQGRXLLSA-N |
| XLogP | 1.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|