C21H21N5O4 — CID 74801780
N-[3-cyclopropyl-1-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-5-yl]-3,4-dimethoxybenzamide (PubChem CID 74801780) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[3-cyclopropyl-1-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-5-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-cyclopropyl-1-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-5-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 74801780 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[3-cyclopropyl-1-(4-methyl-5-methylidene-6-oxopyrimidin-2-yl)pyrazol-5-yl]-3,4-dimethoxybenzamide |
| SMILES | C=C1C(=O)N=C(n2nc(C3CC3)cc2NC(=O)c2ccc(OC)c(OC)c2)N=C1C |
| InChI | InChI=1S/C21H21N5O4/c1-11-12(2)22-21(24-19(11)27)26-18(10-15(25-26)13-5-6-13)23-20(28)14-7-8-16(29-3)17(9-14)30-4/h7-10,13H,1,5-6H2,2-4H3,(H,23,28) |
| InChIKey | ZLIXPZHBGWJEAJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|