C22H27F2N3O2 — CID 74802815
2-[[3-[4-(2,4-difluorophenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]-5-methoxyphenol (PubChem CID 74802815) has the molecular formula C22H27F2N3O2 and a molecular weight of 403.47 g/mol. Its IUPAC name is 2-[[3-[4-(2,4-difluorophenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[3-[4-(2,4-difluorophenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 74802815 |
| Molecular Formula | C22H27F2N3O2 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 2-[[3-[4-(2,4-difluorophenyl)pyrazolidin-3-yl]piperidin-1-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2CCCC(C3NNCC3c3ccc(F)cc3F)C2)c(O)c1 |
| InChI | InChI=1S/C22H27F2N3O2/c1-29-17-6-4-14(21(28)10-17)12-27-8-2-3-15(13-27)22-19(11-25-26-22)18-7-5-16(23)9-20(18)24/h4-7,9-10,15,19,22,25-26,28H,2-3,8,11-13H2,1H3 |
| InChIKey | GCVHPRSQFZVNKD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|