About ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate
ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate (PubChem CID 7481540) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate.
Analyze ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate?
The IUPAC name of ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate (CID 7481540) is ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate.
What is the SMILES notation for ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate?
The canonical SMILES for ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate is CCOC(=O)[C@H](C#N)C1=NCCC1.
What is the InChIKey of ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate?
The InChIKey is XAHXOGGGHMOYEX-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-2-13-9(12)7(6-10)8-4-3-5-11-8/h7H,2-5H2,1H3/t7-/m1/s1.
What are the key properties of ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate?
ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate has a molecular weight of 180.21 g/mol, XLogP of 0.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-cyano-2-(3,4-dihydro-2H-pyrrol-5-yl)acetate is sourced from PubChem (CID 7481540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).