About ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate
ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate (PubChem CID 11286667) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate |
| PubChem CID | 11286667 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate |
| SMILES | CCOC(=O)C1CCN=C1C#N |
| InChI | InChI=1S/C8H10N2O2/c1-2-12-8(11)6-3-4-10-7(6)5-9/h6H,2-4H2,1H3 |
| InChIKey | VAQLBRTXMUUKMD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate?
The IUPAC name of ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate (CID 11286667) is ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate.
What is the SMILES notation for ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate?
The canonical SMILES for ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate is CCOC(=O)C1CCN=C1C#N.
What is the InChIKey of ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate?
The InChIKey is VAQLBRTXMUUKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-2-12-8(11)6-3-4-10-7(6)5-9/h6H,2-4H2,1H3.
What are the key properties of ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate?
ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate has a molecular weight of 166.18 g/mol, XLogP of 0.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-cyano-3,4-dihydro-2H-pyrrole-4-carboxylate is sourced from PubChem (CID 11286667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).