C16H17FN4O — CID 7481681
2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]iminomethyl]propanedinitrile (PubChem CID 7481681) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]iminomethyl]propanedinitrile.
| Compound Name | 2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]iminomethyl]propanedinitrile |
|---|---|
| PubChem CID | 7481681 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]iminomethyl]propanedinitrile |
| SMILES | N#CC(C#N)/C=N/C[C@@H](c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H17FN4O/c17-15-3-1-14(2-4-15)16(21-5-7-22-8-6-21)12-20-11-13(9-18)10-19/h1-4,11,13,16H,5-8,12H2/b20-11+/t16-/m0/s1 |
| InChIKey | FDOLXENLZBZMLW-YODDIOPGSA-N |
| XLogP | 1.93 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|