C21H18N4O — CID 748602
4-(3,5-diphenylpyrazol-1-yl)-6-ethoxypyrimidine (PubChem CID 748602) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-(3,5-diphenylpyrazol-1-yl)-6-ethoxypyrimidine.
| Compound Name | 4-(3,5-diphenylpyrazol-1-yl)-6-ethoxypyrimidine |
|---|---|
| PubChem CID | 748602 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-(3,5-diphenylpyrazol-1-yl)-6-ethoxypyrimidine |
| SMILES | CCOc1cc(-n2nc(-c3ccccc3)cc2-c2ccccc2)ncn1 |
| InChI | InChI=1S/C21H18N4O/c1-2-26-21-14-20(22-15-23-21)25-19(17-11-7-4-8-12-17)13-18(24-25)16-9-5-3-6-10-16/h3-15H,2H2,1H3 |
| InChIKey | UYDZBLMLDZOCQO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |