C9H5FN2 — CID 74891552
5-ethynyl-4-fluoro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 74891552) has the molecular formula C9H5FN2 and a molecular weight of 160.15 g/mol. Its IUPAC name is 5-ethynyl-4-fluoro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-ethynyl-4-fluoro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 74891552 |
| Molecular Formula | C9H5FN2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 5-ethynyl-4-fluoro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C#Cc1cnc2[nH]ccc2c1F |
| InChI | InChI=1S/C9H5FN2/c1-2-6-5-12-9-7(8(6)10)3-4-11-9/h1,3-5H,(H,11,12) |
| InChIKey | OQSZSSZQGXVLRA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|