C13H7ClN4 — CID 156786304
4-chloro-5-(2-pyrimidin-2-ylethynyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 156786304) has the molecular formula C13H7ClN4 and a molecular weight of 254.68 g/mol. Its IUPAC name is 4-chloro-5-(2-pyrimidin-2-ylethynyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-chloro-5-(2-pyrimidin-2-ylethynyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156786304 |
| Molecular Formula | C13H7ClN4 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 4-chloro-5-(2-pyrimidin-2-ylethynyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1c(C#Cc2ncccn2)cnc2[nH]ccc12 |
| InChI | InChI=1S/C13H7ClN4/c14-12-9(2-3-11-15-5-1-6-16-11)8-18-13-10(12)4-7-17-13/h1,4-8H,(H,17,18) |
| InChIKey | SKKUVXZLAOLDNE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|