C21H19N5 — CID 156786298
2-[2-[4-(cyclohexylamino)-1H-pyrrolo[2,3-b]pyridin-5-yl]ethynyl]pyridine-3-carbonitrile (PubChem CID 156786298) has the molecular formula C21H19N5 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[2-[4-(cyclohexylamino)-1H-pyrrolo[2,3-b]pyridin-5-yl]ethynyl]pyridine-3-carbonitrile.
| Compound Name | 2-[2-[4-(cyclohexylamino)-1H-pyrrolo[2,3-b]pyridin-5-yl]ethynyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 156786298 |
| Molecular Formula | C21H19N5 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[2-[4-(cyclohexylamino)-1H-pyrrolo[2,3-b]pyridin-5-yl]ethynyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1C#Cc1cnc2[nH]ccc2c1NC1CCCCC1 |
| InChI | InChI=1S/C21H19N5/c22-13-15-5-4-11-23-19(15)9-8-16-14-25-21-18(10-12-24-21)20(16)26-17-6-2-1-3-7-17/h4-5,10-12,14,17H,1-3,6-7H2,(H2,24,25,26) |
| InChIKey | SQYCUYQEFPNMPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|