C19H17N3 — CID 25267714
4-[2-(2-cyclopentylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 25267714) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-[2-(2-cyclopentylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-[2-(2-cyclopentylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 25267714 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-[2-(2-cyclopentylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | C(#Cc1ncnc2[nH]ccc12)c1ccccc1C1CCCC1 |
| InChI | InChI=1S/C19H17N3/c1-2-6-14(5-1)16-8-4-3-7-15(16)9-10-18-17-11-12-20-19(17)22-13-21-18/h3-4,7-8,11-14H,1-2,5-6H2,(H,20,21,22) |
| InChIKey | YBEIDZCAMOOSPG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|