C24H29N5O2 — CID 7489574
N-[4-[2-[5-(4-propan-2-ylphenyl)tetrazol-2-yl]acetyl]phenyl]hexanamide (PubChem CID 7489574) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[2-[5-(4-propan-2-ylphenyl)tetrazol-2-yl]acetyl]phenyl]hexanamide.
| Compound Name | N-[4-[2-[5-(4-propan-2-ylphenyl)tetrazol-2-yl]acetyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 7489574 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-[2-[5-(4-propan-2-ylphenyl)tetrazol-2-yl]acetyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)Cn2nnc(-c3ccc(C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-4-5-6-7-23(31)25-21-14-12-19(13-15-21)22(30)16-29-27-24(26-28-29)20-10-8-18(9-11-20)17(2)3/h8-15,17H,4-7,16H2,1-3H3,(H,25,31) |
| InChIKey | JIZKMNVGCKWWPT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|