C21H22N2O3S — CID 74908928
3-(3,4-dimethoxyphenyl)-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 74908928) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 74908928 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(3,5,6-trimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)/N=c2\sc3cc(C)c(C)cc3n2C)cc1OC |
| InChI | InChI=1S/C21H22N2O3S/c1-13-10-16-19(11-14(13)2)27-21(23(16)3)22-20(24)9-7-15-6-8-17(25-4)18(12-15)26-5/h6-12H,1-5H3/b9-7?,22-21- |
| InChIKey | HDJMNKSCBATETF-YQESXNBDSA-N |
| XLogP | 4.01 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|