C22H24N6O2 — CID 74924709
1-[1-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]-3-phenylurea (PubChem CID 74924709) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[1-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]-3-phenylurea.
| Compound Name | 1-[1-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]-3-phenylurea |
|---|---|
| PubChem CID | 74924709 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[1-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]-3-phenylurea |
| SMILES | CCC1CC(=O)NC(n2nc(-c3ccccc3)cc2NC(=O)Nc2ccccc2)N1 |
| InChI | InChI=1S/C22H24N6O2/c1-2-16-13-20(29)26-21(23-16)28-19(14-18(27-28)15-9-5-3-6-10-15)25-22(30)24-17-11-7-4-8-12-17/h3-12,14,16,21,23H,2,13H2,1H3,(H,26,29)(H2,24,25,30) |
| InChIKey | WXYXKQDRUBWBIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |