C21H28N6O2 — CID 74924593
1-cyclohexyl-3-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]urea (PubChem CID 74924593) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]urea |
|---|---|
| PubChem CID | 74924593 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-cyclohexyl-3-[1-(4-methyl-6-oxo-1,3-diazinan-2-yl)-3-phenylpyrazol-5-yl]urea |
| SMILES | CC1CC(=O)NC(n2nc(-c3ccccc3)cc2NC(=O)NC2CCCCC2)N1 |
| InChI | InChI=1S/C21H28N6O2/c1-14-12-19(28)25-20(22-14)27-18(13-17(26-27)15-8-4-2-5-9-15)24-21(29)23-16-10-6-3-7-11-16/h2,4-5,8-9,13-14,16,20,22H,3,6-7,10-12H2,1H3,(H,25,28)(H2,23,24,29) |
| InChIKey | KCOYNIHNMJBCHX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |