C15H12BrF3N2O — CID 7492494
2-(4-bromoanilino)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 7492494) has the molecular formula C15H12BrF3N2O and a molecular weight of 373.17 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7492494 |
| Molecular Formula | C15H12BrF3N2O |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-(4-bromoanilino)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNc1ccc(Br)cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H12BrF3N2O/c16-10-5-7-11(8-6-10)20-9-14(22)21-13-4-2-1-3-12(13)15(17,18)19/h1-8,20H,9H2,(H,21,22) |
| InChIKey | OOTDGAPOXKEDRM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |