C15H11BrF4N2O — CID 7922871
2-[4-bromo-3-(trifluoromethyl)anilino]-N-(2-fluorophenyl)acetamide (PubChem CID 7922871) has the molecular formula C15H11BrF4N2O and a molecular weight of 391.16 g/mol. Its IUPAC name is 2-[4-bromo-3-(trifluoromethyl)anilino]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[4-bromo-3-(trifluoromethyl)anilino]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7922871 |
| Molecular Formula | C15H11BrF4N2O |
| Molecular Weight | 391.16 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 2-[4-bromo-3-(trifluoromethyl)anilino]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CNc1ccc(Br)c(C(F)(F)F)c1)Nc1ccccc1F |
| InChI | InChI=1S/C15H11BrF4N2O/c16-11-6-5-9(7-10(11)15(18,19)20)21-8-14(23)22-13-4-2-1-3-12(13)17/h1-7,21H,8H2,(H,22,23) |
| InChIKey | QYIKANBZARHPDC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |