C18H21N5O6S — CID 74925313
N-(3,4-dimethoxyphenyl)-2-[[5-[(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 74925313) has the molecular formula C18H21N5O6S and a molecular weight of 435.46 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[[5-[(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[[5-[(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 74925313 |
| Molecular Formula | C18H21N5O6S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[[5-[(4-methyl-2,6-dioxo-1,3-diazinan-5-yl)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nnc(CC3C(=O)NC(=O)NC3C)o2)cc1OC |
| InChI | InChI=1S/C18H21N5O6S/c1-9-11(16(25)21-17(26)19-9)7-15-22-23-18(29-15)30-8-14(24)20-10-4-5-12(27-2)13(6-10)28-3/h4-6,9,11H,7-8H2,1-3H3,(H,20,24)(H2,19,21,25,26) |
| InChIKey | MVQYZATXYQHNAQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 144.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |