C15H14F2N4O3S — CID 74925350
5-[[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-6-methyl-1,3-diazinane-2,4-dione (PubChem CID 74925350) has the molecular formula C15H14F2N4O3S and a molecular weight of 368.37 g/mol. Its IUPAC name is 5-[[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-6-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-[[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-6-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 74925350 |
| Molecular Formula | C15H14F2N4O3S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-[[5-[(3,4-difluorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]methyl]-6-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1NC(=O)NC(=O)C1Cc1nnc(SCc2ccc(F)c(F)c2)o1 |
| InChI | InChI=1S/C15H14F2N4O3S/c1-7-9(13(22)19-14(23)18-7)5-12-20-21-15(24-12)25-6-8-2-3-10(16)11(17)4-8/h2-4,7,9H,5-6H2,1H3,(H2,18,19,22,23) |
| InChIKey | AMHHDXUOOKXGFG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |