C12H24O5Si — CID 74943933
4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-5-oxopentanoic acid (PubChem CID 74943933) has the molecular formula C12H24O5Si and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-5-oxopentanoic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 74943933 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)C(CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O5Si/c1-12(2,3)18(5,6)17-9(11(15)16-4)7-8-10(13)14/h9H,7-8H2,1-6H3,(H,13,14) |
| InChIKey | MBUANYNMZYTZSC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|