C13H28O4Si — CID 14992914
ethyl (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypentanoate (PubChem CID 14992914) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is ethyl (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypentanoate.
| Compound Name | ethyl (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypentanoate |
|---|---|
| PubChem CID | 14992914 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl (2S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypentanoate |
| SMILES | CCOC(=O)[C@@H](O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-7-16-12(15)11(14)9-8-10-17-18(5,6)13(2,3)4/h11,14H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | HTESVMOVOGLTPR-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|