C15H15N3O3 — CID 74945357
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] pyrazine-2-carboxylate (PubChem CID 74945357) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] pyrazine-2-carboxylate.
| Compound Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 74945357 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] pyrazine-2-carboxylate |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=NOC(=O)c1cnccn1 |
| InChI | InChI=1S/C15H15N3O3/c1-9(2)11-7-12(10(3)6-14(11)19)18-21-15(20)13-8-16-4-5-17-13/h4-9H,1-3H3 |
| InChIKey | IPFPQVVPTZSBQC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|