C25H27N5O3 — CID 74953189
2-methoxyimino-3-methyl-N-[4-(2-methyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine-6-carbonyl)phenyl]butanamide (PubChem CID 74953189) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-methoxyimino-3-methyl-N-[4-(2-methyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine-6-carbonyl)phenyl]butanamide.
| Compound Name | 2-methoxyimino-3-methyl-N-[4-(2-methyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine-6-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 74953189 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-methoxyimino-3-methyl-N-[4-(2-methyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine-6-carbonyl)phenyl]butanamide |
| SMILES | CON=C(C(=O)Nc1ccc(C(=O)N2CCc3[nH]c(C)nc3-c3ccccc32)cc1)C(C)C |
| InChI | InChI=1S/C25H27N5O3/c1-15(2)22(29-33-4)24(31)28-18-11-9-17(10-12-18)25(32)30-14-13-20-23(27-16(3)26-20)19-7-5-6-8-21(19)30/h5-12,15H,13-14H2,1-4H3,(H,26,27)(H,28,31) |
| InChIKey | KWBPAUGYCCZHLG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|