C22H15ClF3N5O — CID 74955884
N-[3-[2-(6-chloropurin-9-yl)ethenyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 74955884) has the molecular formula C22H15ClF3N5O and a molecular weight of 457.84 g/mol. Its IUPAC name is N-[3-[2-(6-chloropurin-9-yl)ethenyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[2-(6-chloropurin-9-yl)ethenyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 74955884 |
| Molecular Formula | C22H15ClF3N5O |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | N-[3-[2-(6-chloropurin-9-yl)ethenyl]-4-methylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1C=Cn1cnc2c(Cl)ncnc21 |
| InChI | InChI=1S/C22H15ClF3N5O/c1-13-5-6-17(30-21(32)15-3-2-4-16(9-15)22(24,25)26)10-14(13)7-8-31-12-29-18-19(23)27-11-28-20(18)31/h2-12H,1H3,(H,30,32) |
| InChIKey | DNZUEOJANSLZNH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |