C30H36F3N5O4S — CID 74957890
N-(5-hydroxy-2-adamantyl)-4-[4-[4-(trifluoromethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 74957890) has the molecular formula C30H36F3N5O4S and a molecular weight of 619.71 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-4-[4-[4-(trifluoromethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-4-[4-[4-(trifluoromethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 74957890 |
| Molecular Formula | C30H36F3N5O4S |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-4-[4-[4-(trifluoromethylsulfonyl)piperazin-1-yl]phenyl]-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)N1CCN(c2ccc(N3CCN(S(=O)(=O)C(F)(F)F)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H36F3N5O4S/c31-30(32,33)43(41,42)36-11-9-35(10-12-36)23-5-7-24(8-6-23)37-13-14-38(26-4-2-1-3-25(26)37)28(39)34-27-21-15-20-16-22(27)19-29(40,17-20)18-21/h1-8,20-22,27,40H,9-19H2,(H,34,39) |
| InChIKey | KOZHYKTZKJGGOQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|