C20H21N3O5S — CID 74961310
2-(benzenesulfonyl)-2-diazo-1-[4-(3-methoxyphenyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone (PubChem CID 74961310) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-diazo-1-[4-(3-methoxyphenyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-2-diazo-1-[4-(3-methoxyphenyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 74961310 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(benzenesulfonyl)-2-diazo-1-[4-(3-methoxyphenyl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
| SMILES | COc1cccc(C2COC(C)(C)N2C(=O)C(=[N+]=[N-])S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H21N3O5S/c1-20(2)23(17(13-28-20)14-8-7-9-15(12-14)27-3)19(24)18(22-21)29(25,26)16-10-5-4-6-11-16/h4-12,17H,13H2,1-3H3 |
| InChIKey | WJSQTMBYODUAJF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|