C14H19N3O3S — CID 71359359
2-(benzenesulfonyl)-2-diazo-N,N-di(propan-2-yl)acetamide (PubChem CID 71359359) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-diazo-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-(benzenesulfonyl)-2-diazo-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 71359359 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(benzenesulfonyl)-2-diazo-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)C(=[N+]=[N-])S(=O)(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C14H19N3O3S/c1-10(2)17(11(3)4)14(18)13(16-15)21(19,20)12-8-6-5-7-9-12/h5-11H,1-4H3 |
| InChIKey | VOVUGFBPLFVUFB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|