C15H20N4O2 — CID 101021188
3-azido-2-oxo-3-phenyl-N,N-di(propan-2-yl)propanamide (PubChem CID 101021188) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-azido-2-oxo-3-phenyl-N,N-di(propan-2-yl)propanamide.
| Compound Name | 3-azido-2-oxo-3-phenyl-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 101021188 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-azido-2-oxo-3-phenyl-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)C(=O)C(N=[N+]=[N-])c1ccccc1)C(C)C |
| InChI | InChI=1S/C15H20N4O2/c1-10(2)19(11(3)4)15(21)14(20)13(17-18-16)12-8-6-5-7-9-12/h5-11,13H,1-4H3 |
| InChIKey | PRUBRYSZJNEMRS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|