C13H16N6 — CID 90761854
[1-azido-2-(azidomethylidene)-3,3-dimethylbutyl]benzene (PubChem CID 90761854) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is [1-azido-2-(azidomethylidene)-3,3-dimethylbutyl]benzene.
| Compound Name | [1-azido-2-(azidomethylidene)-3,3-dimethylbutyl]benzene |
|---|---|
| PubChem CID | 90761854 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [1-azido-2-(azidomethylidene)-3,3-dimethylbutyl]benzene |
| SMILES | CC(C)(C)C(=CN=[N+]=[N-])C(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C13H16N6/c1-13(2,3)11(9-16-18-14)12(17-19-15)10-7-5-4-6-8-10/h4-9,12H,1-3H3 |
| InChIKey | QUQTYIVBPLHTKI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|