C11H11N5O2 — CID 18598721
(2S)-2-azido-N-(2-oxoazetidin-3-yl)-2-phenylacetamide (PubChem CID 18598721) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is (2S)-2-azido-N-(2-oxoazetidin-3-yl)-2-phenylacetamide.
| Compound Name | (2S)-2-azido-N-(2-oxoazetidin-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 18598721 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (2S)-2-azido-N-(2-oxoazetidin-3-yl)-2-phenylacetamide |
| SMILES | [N-]=[N+]=N[C@H](C(=O)NC1CNC1=O)c1ccccc1 |
| InChI | InChI=1S/C11H11N5O2/c12-16-15-9(7-4-2-1-3-5-7)11(18)14-8-6-13-10(8)17/h1-5,8-9H,6H2,(H,13,17)(H,14,18)/t8?,9-/m0/s1 |
| InChIKey | STQJSDQOLQPJNI-GKAPJAKFSA-N |
| XLogP | 0.65 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|