C23H25N3O2 — CID 7497560
N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide (PubChem CID 7497560) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7497560 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(2S)-2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2ccco2)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-25(2)19-11-9-18(10-12-19)21(16-24-23(27)22-8-5-15-28-22)26-14-13-17-6-3-4-7-20(17)26/h3-12,15,21H,13-14,16H2,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | ILJMHRJXOQSNJU-OAQYLSRUSA-N |
| XLogP | 3.88 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|