C29H35N3O — CID 20962669
4-tert-butyl-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzamide (PubChem CID 20962669) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 20962669 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | 4-tert-butyl-N-[2-(2,3-dihydroindol-1-yl)-2-[4-(dimethylamino)phenyl]ethyl]benzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2ccc(C(C)(C)C)cc2)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C29H35N3O/c1-29(2,3)24-14-10-23(11-15-24)28(33)30-20-27(22-12-16-25(17-13-22)31(4)5)32-19-18-21-8-6-7-9-26(21)32/h6-17,27H,18-20H2,1-5H3,(H,30,33) |
| InChIKey | XIIDIAMKFKJLFE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|