C27H28F3N3O — CID 27420253
N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 27420253) has the molecular formula C27H28F3N3O and a molecular weight of 467.54 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 27420253 |
| Molecular Formula | C27H28F3N3O |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[(2S)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2ccc(C(F)(F)F)cc2)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C27H28F3N3O/c1-32(2)24-13-9-20(10-14-24)25(33-16-15-19-5-3-4-6-22(19)18-33)17-31-26(34)21-7-11-23(12-8-21)27(28,29)30/h3-14,25H,15-18H2,1-2H3,(H,31,34)/t25-/m1/s1 |
| InChIKey | FWJUKSJROFUWJW-RUZDIDTESA-N |
| XLogP | 5.30 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|