C24H26BrN3O2 — CID 43956293
5-bromo-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide (PubChem CID 43956293) has the molecular formula C24H26BrN3O2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43956293 |
| Molecular Formula | C24H26BrN3O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 5-bromo-N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-[4-(dimethylamino)phenyl]ethyl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2ccc(Br)o2)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C24H26BrN3O2/c1-27(2)20-9-7-18(8-10-20)21(15-26-24(29)22-11-12-23(25)30-22)28-14-13-17-5-3-4-6-19(17)16-28/h3-12,21H,13-16H2,1-2H3,(H,26,29) |
| InChIKey | IGZYAQAHTIXAGF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|