C22H25N3O3S — CID 7499091
4-(1,1-dioxothiazinan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzamide (PubChem CID 7499091) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzamide.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 7499091 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-N-[2-(1H-indol-3-yl)ethyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCCc2c[nH]c3ccccc23)ccc1N1CCCCS1(=O)=O |
| InChI | InChI=1S/C22H25N3O3S/c1-16-14-17(8-9-21(16)25-12-4-5-13-29(25,27)28)22(26)23-11-10-18-15-24-20-7-3-2-6-19(18)20/h2-3,6-9,14-15,24H,4-5,10-13H2,1H3,(H,23,26) |
| InChIKey | IYQBAYUQROGPEY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |