C18H24N2O4 — CID 750039
2-[(3R,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-3-yl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 750039) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[(3R,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-3-yl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(3R,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-3-yl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 750039 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[(3R,9aS)-4-oxo-1,6,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-3-yl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)C[C@H]2OC[C@@H]3CCCCN3C2=O)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-2-23-15-8-6-13(7-9-15)19-17(21)11-16-18(22)20-10-4-3-5-14(20)12-24-16/h6-9,14,16H,2-5,10-12H2,1H3,(H,19,21)/t14-,16+/m0/s1 |
| InChIKey | XVIVVWPEWLTKLH-GOEBONIOSA-N |
| XLogP | 2.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |