C19H21N3O5S — CID 7501644
ethyl (2S)-2-[[3-(2-methoxyethyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 7501644) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-(2-methoxyethyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2S)-2-[[3-(2-methoxyethyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7501644 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl (2S)-2-[[3-(2-methoxyethyl)-4-oxo-5H-pyrimido[5,4-b]indol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](Sc1nc2c([nH]c3ccccc32)c(=O)n1CCOC)C(C)=O |
| InChI | InChI=1S/C19H21N3O5S/c1-4-27-18(25)16(11(2)23)28-19-21-14-12-7-5-6-8-13(12)20-15(14)17(24)22(19)9-10-26-3/h5-8,16,20H,4,9-10H2,1-3H3/t16-/m0/s1 |
| InChIKey | HYSGYCZLVMORDW-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|