C14H15F2N3O2S — CID 7502437
N-[(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)methyl]-2,6-difluorobenzamide (PubChem CID 7502437) has the molecular formula C14H15F2N3O2S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)methyl]-2,6-difluorobenzamide.
| Compound Name | N-[(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)methyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 7502437 |
| Molecular Formula | C14H15F2N3O2S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)methyl]-2,6-difluorobenzamide |
| SMILES | CCCCSc1nnc(CNC(=O)c2c(F)cccc2F)o1 |
| InChI | InChI=1S/C14H15F2N3O2S/c1-2-3-7-22-14-19-18-11(21-14)8-17-13(20)12-9(15)5-4-6-10(12)16/h4-6H,2-3,7-8H2,1H3,(H,17,20) |
| InChIKey | JYGJOVKXSBEHIY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|