C16H15F2N3O5S — CID 7502485
ethyl (2R)-2-[[5-[[(2,6-difluorobenzoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 7502485) has the molecular formula C16H15F2N3O5S and a molecular weight of 399.38 g/mol. Its IUPAC name is ethyl (2R)-2-[[5-[[(2,6-difluorobenzoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[[5-[[(2,6-difluorobenzoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 7502485 |
| Molecular Formula | C16H15F2N3O5S |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | ethyl (2R)-2-[[5-[[(2,6-difluorobenzoyl)amino]methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](Sc1nnc(CNC(=O)c2c(F)cccc2F)o1)C(C)=O |
| InChI | InChI=1S/C16H15F2N3O5S/c1-3-25-15(24)13(8(2)22)27-16-21-20-11(26-16)7-19-14(23)12-9(17)5-4-6-10(12)18/h4-6,13H,3,7H2,1-2H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | YIVRJTQLZNZTMD-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|