C14H15N3O4S — CID 134066175
ethyl 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 134066175) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is ethyl 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 134066175 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nnc(-c2ccc(N)cc2)o1)C(C)=O |
| InChI | InChI=1S/C14H15N3O4S/c1-3-20-13(19)11(8(2)18)22-14-17-16-12(21-14)9-4-6-10(15)7-5-9/h4-7,11H,3,15H2,1-2H3 |
| InChIKey | GIEKCIFSHCJCES-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|