C15H22N2 — CID 750316
(1R,5S)-N-benzyl-8-methyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 750316) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (1R,5S)-N-benzyl-8-methyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | (1R,5S)-N-benzyl-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 750316 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (1R,5S)-N-benzyl-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1[C@@H]2CC[C@H]1CC(NCc1ccccc1)C2 |
| InChI | InChI=1S/C15H22N2/c1-17-14-7-8-15(17)10-13(9-14)16-11-12-5-3-2-4-6-12/h2-6,13-16H,7-11H2,1H3/t13?,14-,15+ |
| InChIKey | IJBWOPMYRYEKGI-GOOCMWNKSA-N |
| XLogP | 2.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |