C19H15BrFN3O — CID 7504750
(E)-N-[2-[(4-bromophenyl)methyl]pyrazol-3-yl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 7504750) has the molecular formula C19H15BrFN3O and a molecular weight of 400.25 g/mol. Its IUPAC name is (E)-N-[2-[(4-bromophenyl)methyl]pyrazol-3-yl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(4-bromophenyl)methyl]pyrazol-3-yl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7504750 |
| Molecular Formula | C19H15BrFN3O |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | (E)-N-[2-[(4-bromophenyl)methyl]pyrazol-3-yl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)Nc1ccnn1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15BrFN3O/c20-16-7-4-15(5-8-16)13-24-18(10-11-22-24)23-19(25)9-6-14-2-1-3-17(21)12-14/h1-12H,13H2,(H,23,25)/b9-6+ |
| InChIKey | HFDTXIVRLQUFBX-RMKNXTFCSA-N |
| XLogP | 4.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|