C18H15ClN4O — CID 76858064
N-[2-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 76858064) has the molecular formula C18H15ClN4O and a molecular weight of 338.80 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | N-[2-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 76858064 |
| Molecular Formula | C18H15ClN4O |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methyl]pyrazol-3-yl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccnc1)Nc1ccnn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN4O/c19-16-6-3-15(4-7-16)13-23-17(9-11-21-23)22-18(24)8-5-14-2-1-10-20-12-14/h1-12H,13H2,(H,22,24) |
| InChIKey | ZROKWTNRROSFCS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|